4-Peroxycyclophosphamide, all R
Modify Date: 2026-07-19 23:56:28
4-Peroxycyclophosphamide, all R structure
|
Common Name | 4-Peroxycyclophosphamide, all R | ||
|---|---|---|---|---|
| CAS Number | 146566-41-8 | Molecular Weight | 552.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H28Cl4N4O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Peroxycyclophosphamide, all R |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H28Cl4N4O6P2 |
|---|---|
| Molecular Weight | 552.1 |
| InChIKey | MBXBDDYOYWGZID-OMKCPPEXSA-N |
| SMILES | O=P1(N(CCCl)CCCl)NC(OOC2CCOP(=O)(N(CCCl)CCCl)N2)CCO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Peroxycyclophosphamide, all R? |
| A: InChIKey of 4-Peroxycyclophosphamide, all R is MBXBDDYOYWGZID-OMKCPPEXSA-N. |
| Q: What is the molecular weight of 4-Peroxycyclophosphamide, all R? |
| A: Molecular weight of 4-Peroxycyclophosphamide, all R is 552.1. |
| Q: What is the CAS number of 4-Peroxycyclophosphamide, all R? |
| A: CAS number of 4-Peroxycyclophosphamide, all R is 146566-41-8. |
| Q: What is the SMILES notation of 4-Peroxycyclophosphamide, all R? |
| A: SMILES notation of 4-Peroxycyclophosphamide, all R is O=P1(N(CCCl)CCCl)NC(OOC2CCOP(=O)(N(CCCl)CCCl)N2)CCO1. |
| Q: What is the molecular formula of 4-Peroxycyclophosphamide, all R? |
| A: Molecular formula of 4-Peroxycyclophosphamide, all R is C14H28Cl4N4O6P2. |
| Q: What is the Chinese name of 146566-41-8? |
| A: Chinese name of 146566-41-8 is 146566-41-8. |
| Q: What is the English name of 4-Peroxycyclophosphamide, all R? |
| A: The English name of 4-Peroxycyclophosphamide, all R is 4-Peroxycyclophosphamide, all R. |