Benzoic acid,5-(2-carboxyethenyl)-2-hydroxy- structure
|
Common Name | Benzoic acid,5-(2-carboxyethenyl)-2-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 14663-61-7 | Molecular Weight | 208.16800 | |
| Density | 1.53g/cm3 | Boiling Point | 454.3ºC at 760 mmHg | |
| Molecular Formula | C10H8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.7ºC | |
| Name | 5-[(E)-2-carboxyethenyl]-2-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 454.3ºC at 760 mmHg |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.16800 |
| Flash Point | 242.7ºC |
| Exact Mass | 208.03700 |
| PSA | 94.83000 |
| LogP | 1.18820 |
| Vapour Pressure | 4.8E-09mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | DUUHXURROBQQSE-DUXPYHPUSA-N |
| SMILES | O=C(O)C=Cc1ccc(O)c(C(=O)O)c1 |
|
~%
Benzoic acid,5-... CAS#:14663-61-7 |
| Literature: Axys Pharmaceuticals, Inc. Patent: US6867200 B1, 2005 ; Location in patent: Page/Page column 62 ; US 6867200 B1 |
|
~%
Benzoic acid,5-... CAS#:14663-61-7 |
| Literature: Wayne; Cohen Journal of the Chemical Society, 1922 , vol. 121, p. 1027 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-carboxy-4-hydroxy-cinnamic acid |
| 3-Carboxy-4-hydroxy-zimtsaeure |