p-Methoxybenzyl tosylate
Modify Date: 2026-07-12 14:44:02
p-Methoxybenzyl tosylate structure
|
Common Name | p-Methoxybenzyl tosylate | ||
|---|---|---|---|---|
| CAS Number | 14670-03-2 | Molecular Weight | 292.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | p-Methoxybenzyl tosylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16O4S |
|---|---|
| Molecular Weight | 292.4 |
| InChIKey | SQFYVRPTXWDXKK-UHFFFAOYSA-N |
| SMILES | COc1ccc(COS(=O)(=O)c2ccc(C)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of p-Methoxybenzyl tosylate? |
| A: Molecular weight of p-Methoxybenzyl tosylate is 292.4. |
| Q: What is the CAS number of p-Methoxybenzyl tosylate? |
| A: CAS number of p-Methoxybenzyl tosylate is 14670-03-2. |
| Q: What is the English name of p-Methoxybenzyl tosylate? |
| A: The English name of p-Methoxybenzyl tosylate is p-Methoxybenzyl tosylate. |
| Q: What is the Chinese name of 14670-03-2? |
| A: Chinese name of 14670-03-2 is 14670-03-2. |
| Q: What is the InChIKey of p-Methoxybenzyl tosylate? |
| A: InChIKey of p-Methoxybenzyl tosylate is SQFYVRPTXWDXKK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of p-Methoxybenzyl tosylate? |
| A: SMILES notation of p-Methoxybenzyl tosylate is COc1ccc(COS(=O)(=O)c2ccc(C)cc2)cc1. |
| Q: What is the molecular formula of p-Methoxybenzyl tosylate? |
| A: Molecular formula of p-Methoxybenzyl tosylate is C15H16O4S. |