acetic acid,1-(2,4,5-trimethoxyphenyl)propane-1,2-diol structure
|
Common Name | acetic acid,1-(2,4,5-trimethoxyphenyl)propane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 146830-07-1 | Molecular Weight | 362.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,1-(2,4,5-trimethoxyphenyl)propane-1,2-diol |
|---|
| Molecular Formula | C16H26O9 |
|---|---|
| Molecular Weight | 362.37200 |
| Exact Mass | 362.15800 |
| PSA | 142.75000 |
| LogP | 1.30840 |
| InChIKey | FAHKBXQYLBQSBM-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)O.COc1cc(OC)c(C(O)C(C)O)cc1OC |
|
~%
acetic acid,1-(... CAS#:146830-07-1 |
| Literature: Rao; Subramaniam Journal of the Chemical Society, 1937 , p. 1338 |
|
~%
acetic acid,1-(... CAS#:146830-07-1 |
| Literature: Rao; Subramaniam Journal of the Chemical Society, 1937 , p. 1338 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |