5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione
Modify Date: 2025-08-30 07:04:43
5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione structure
|
Common Name | 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione | ||
|---|---|---|---|---|
| CAS Number | 146830-73-1 | Molecular Weight | 210.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14N4O2 |
|---|---|
| Molecular Weight | 210.23 |
| InChIKey | KOFDGZMEBAVMSB-UHFFFAOYSA-N |
| SMILES | Nc1[nH]c(=O)n(C2CCCC2)c(=O)c1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione? |
| A: CAS number of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione is 146830-73-1. |
| Q: What is the InChIKey of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione? |
| A: InChIKey of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione is KOFDGZMEBAVMSB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione? |
| A: Molecular weight of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione is 210.23. |
| Q: What is the molecular formula of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione? |
| A: Molecular formula of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione is C9H14N4O2. |
| Q: What is the Chinese name of 146830-73-1? |
| A: Chinese name of 146830-73-1 is 146830-73-1. |
| Q: What is the English name of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione? |
| A: The English name of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione is 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione. |
| Q: What is the SMILES notation of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione? |
| A: SMILES notation of 5,6-Diamino-3-cyclopentyl-2,4(1h,3h)-pyrimidinedione is Nc1[nH]c(=O)n(C2CCCC2)c(=O)c1N. |