1,3,5-Pentanetrione,1,5-bis(4-chlorophenyl)- structure
|
Common Name | 1,3,5-Pentanetrione,1,5-bis(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1469-92-7 | Molecular Weight | 335.18100 | |
| Density | 1.335g/cm3 | Boiling Point | 500.4ºC at 760mmHg | |
| Molecular Formula | C17H12Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.5ºC | |
| Name | 1,5-bis(4-chlorophenyl)pentane-1,3,5-trione |
|---|
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 500.4ºC at 760mmHg |
| Molecular Formula | C17H12Cl2O3 |
| Molecular Weight | 335.18100 |
| Flash Point | 209.5ºC |
| Exact Mass | 334.01600 |
| PSA | 51.21000 |
| LogP | 4.40830 |
| Vapour Pressure | 3.81E-10mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | JVGXKNGROPICAX-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccc(Cl)cc1)CC(=O)c1ccc(Cl)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |