Pregn-5-en-20-one,3,16,21-tris(acetyloxy)-17-hydroxy-, (3b,16a)- (9CI) structure
|
Common Name | Pregn-5-en-20-one,3,16,21-tris(acetyloxy)-17-hydroxy-, (3b,16a)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 14697-32-6 | Molecular Weight | 490.58600 | |
| Density | 1.23g/cm3 | Boiling Point | 574.1ºC at 760mmHg | |
| Molecular Formula | C27H38O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.5ºC | |
| Name | [2-(3,16-diacetyloxy-17-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 574.1ºC at 760mmHg |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.58600 |
| Flash Point | 182.5ºC |
| Exact Mass | 490.25700 |
| PSA | 116.20000 |
| LogP | 3.28580 |
| Vapour Pressure | 1.43E-15mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | UOTZPHOHOBMUNX-OWSKVELVSA-N |
| SMILES | CC(=O)OCC(=O)C1(O)C(OC(C)=O)CC2C3CC=C4CC(OC(C)=O)CCC4(C)C3CCC21C |
|
~%
Pregn-5-en-20-o... CAS#:14697-32-6 |
| Literature: Romo; Romo de Vivar Journal of Organic Chemistry, 1956 , vol. 21, p. 902,906 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |