Fmoc-Tyr(All)-OH structure
|
Common Name | Fmoc-Tyr(All)-OH | ||
|---|---|---|---|---|
| CAS Number | 146982-30-1 | Molecular Weight | 443.49100 | |
| Density | 1.247g/cm3 | Boiling Point | 668.7ºC at 760 mmHg | |
| Molecular Formula | C27H25NO5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 358.2ºC | |
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-prop-2-enoxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 668.7ºC at 760 mmHg |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.49100 |
| Flash Point | 358.2ºC |
| Exact Mass | 443.17300 |
| PSA | 84.86000 |
| LogP | 5.17670 |
| Vapour Pressure | 8.62E-19mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | AQUXDQFCBLRIRE-VWLOTQADSA-N |
| SMILES | C=CCOc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Fmoc-O-allyl-L-tyrosine |
| AmbotzFAA1431 |
| Fmoc-Tyr(All)-OH |