dipotassium (R*,R*)-(±)-tartrate
dipotassium (R*,R*)-(±)-tartrate structure
|
Common Name | dipotassium (R*,R*)-(±)-tartrate | ||
|---|---|---|---|---|
| CAS Number | 147-78-4 | Molecular Weight | 188.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H5KO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | potassium hydrogene tartrate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4H5KO6 |
|---|---|
| Molecular Weight | 188.17700 |
| Exact Mass | 187.97200 |
| PSA | 117.89000 |
| InChIKey | AVTYONGGKAJVTE-OLXYHTOASA-L |
| SMILES | O=C([O-])C(O)C(O)C(=O)[O-].[K+].[K+] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:584-08-7
CAS#:75-20-7
CAS#:124-38-9
CAS#:298-14-6
CAS#:7440-57-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| DIPOTASSIUM (R*,R*)-(+/-)-TARTRATE |
| potassium hydrogen tartaric acid |
| potassium hydrogen tartrate |
| tartaric acid monopotassium salt |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of potassium hydrogene tartrate? |
| A: Polar surface area (PSA) of potassium hydrogene tartrate is 117.89000. |
| Q: What is the English name of potassium hydrogene tartrate? |
| A: The English name of potassium hydrogene tartrate is potassium hydrogene tartrate. |
| Q: What is the InChIKey of potassium hydrogene tartrate? |
| A: InChIKey of potassium hydrogene tartrate is AVTYONGGKAJVTE-OLXYHTOASA-L. |
| Q: What are the downstream products of potassium hydrogene tartrate? |
| A: Related downstream products(CAS) of potassium hydrogene tartrate: 584-08-7;75-20-7;124-38-9;298-14-6;7440-57-5. |
| Q: What is the molecular weight of potassium hydrogene tartrate? |
| A: Molecular weight of potassium hydrogene tartrate is 188.17700. |
| Q: What is the molecular formula of potassium hydrogene tartrate? |
| A: Molecular formula of potassium hydrogene tartrate is C4H5KO6. |
| Q: What is the CAS number of potassium hydrogene tartrate? |
| A: CAS number of potassium hydrogene tartrate is 147-78-4. |
| Q: What English synonyms does potassium hydrogene tartrate have? |
| A: English synonyms of potassium hydrogene tartrate: DIPOTASSIUM (R*,R*)-(+/-)-TARTRATE, potassium hydrogen tartaric acid, potassium hydrogen tartrate, tartaric acid monopotassium salt. |
| Q: What is the Chinese name of 147-78-4? |
| A: Chinese name of 147-78-4 is 147-78-4. |
| Q: What is the SMILES notation of potassium hydrogene tartrate? |
| A: SMILES notation of potassium hydrogene tartrate is O=C([O-])C(O)C(O)C(=O)[O-].[K+].[K+]. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |