N-but-3-ynyl-4-methyl-N-(3-methylbut-2-enyl)benzenesulfonamide structure
|
Common Name | N-but-3-ynyl-4-methyl-N-(3-methylbut-2-enyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 147048-26-8 | Molecular Weight | 291.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-but-3-ynyl-4-methyl-N-(3-methylbut-2-enyl)benzenesulfonamide |
|---|
| Molecular Formula | C16H21NO2S |
|---|---|
| Molecular Weight | 291.40800 |
| Exact Mass | 291.12900 |
| PSA | 45.76000 |
| LogP | 4.05600 |
| InChIKey | KRKKYBIKAXEARU-UHFFFAOYSA-N |
| SMILES | C#CCCN(CC=C(C)C)S(=O)(=O)c1ccc(C)cc1 |
|
~84%
N-but-3-ynyl-4-... CAS#:147048-26-8 |
| Literature: Trost, Barry M.; Toste, F. Dean Journal of the American Chemical Society, 2002 , vol. 124, # 18 p. 5025 - 5036 |
|
~48%
N-but-3-ynyl-4-... CAS#:147048-26-8 |
| Literature: Kataoka, Tadashi; Yoshimatsu, Mitsuhiro; Noda, Yoshinori; Sato, Takashi; Shimizu, Hiroshi; Hori, Mikio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 1 p. 121 - 130 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |