2-Butyl-2-ethyl-1,3-propanediol 1,3-dicarbamate structure
|
Common Name | 2-Butyl-2-ethyl-1,3-propanediol 1,3-dicarbamate | ||
|---|---|---|---|---|
| CAS Number | 1471-51-8 | Molecular Weight | 246.30300 | |
| Density | 1.097g/cm3 | Boiling Point | 451.1ºC at 760mmHg | |
| Molecular Formula | C11H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.6ºC | |
| Name | [2-(carbamoyloxymethyl)-2-ethylhexyl] carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 451.1ºC at 760mmHg |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.30300 |
| Flash Point | 216.6ºC |
| Exact Mass | 246.15800 |
| PSA | 106.62000 |
| LogP | 2.79120 |
| Vapour Pressure | 2.5E-08mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | OAUQNCDVPLLEAH-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)(COC(N)=O)COC(N)=O |
| HS Code | 2924199090 |
|---|
|
~%
2-Butyl-2-ethyl... CAS#:1471-51-8 |
| Literature: Schneider,G. et al. Monatshefte fuer Chemie, 1963 , vol. 94, p. 426 - 433 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-ethyl-4-butyl-2,6-dioxa-heptanedioic acid diamide |
| 2-Ethyl-2-n-butyl-1,3-propanediol dicarbamate |
| 1,3-Propanediol,2-butyl-2-ethyl-,dicarbamate |
| 2-Aethyl-2-butyl-1,3-bis-carbamoyloxy-propan |
| 3,3-Bis-carbamoyloxymethyl-heptan |
| 4-Aethyl-4-butyl-2,6-dioxa-heptandisaeure-diamid |
| Ebubamate |