(S)-Tenofovir structure
|
Common Name | (S)-Tenofovir | ||
|---|---|---|---|---|
| CAS Number | 147127-19-3 | Molecular Weight | 287.21200 | |
| Density | 1.79g/cm3 | Boiling Point | 616.1ºC at 760mmHg | |
| Molecular Formula | C9H14N5O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 326.4ºC | |
Use of (S)-Tenofovir(S)-Tenofovir ((S)-GS 1278) is the less active S-enantiomer of Tenofovir. Tenofovir is a nucleotide reverse transcriptase inhibitor to treat HIV and chronic Hepatitis B (HBV)[1]. |
| Name | [(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-Tenofovir ((S)-GS 1278) is the less active S-enantiomer of Tenofovir. Tenofovir is a nucleotide reverse transcriptase inhibitor to treat HIV and chronic Hepatitis B (HBV)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.79g/cm3 |
|---|---|
| Boiling Point | 616.1ºC at 760mmHg |
| Molecular Formula | C9H14N5O4P |
| Molecular Weight | 287.21200 |
| Flash Point | 326.4ºC |
| Exact Mass | 287.07800 |
| PSA | 146.19000 |
| LogP | 0.53000 |
| Vapour Pressure | 4.92E-16mmHg at 25°C |
| Index of Refraction | 1.739 |
| InChIKey | SGOIRFVFHAKUTI-LURJTMIESA-N |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(=O)(O)O |
| Storage condition | 2-8°C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (S)-9-(2-Phosphonomethoxypropyl)adenine |
| (S)-PMPA |
| (S)-Tenofovir |
| Phosphonic acid,P-[[(1S)-2-(6-amino-9H-purin-9-yl)-1-methylethoxy]methyl]- |