2-Oxazolidinone,5-[(4-chlorophenoxy)methyl]- structure
|
Common Name | 2-Oxazolidinone,5-[(4-chlorophenoxy)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 14716-97-3 | Molecular Weight | 227.64400 | |
| Density | 1.31g/cm3 | Boiling Point | 457.9ºC at 760mmHg | |
| Molecular Formula | C10H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.7ºC | |
| Name | 5-[(4-chlorophenoxy)methyl]-1,3-oxazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 457.9ºC at 760mmHg |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.64400 |
| Flash Point | 230.7ºC |
| Exact Mass | 227.03500 |
| PSA | 47.56000 |
| LogP | 2.15600 |
| Vapour Pressure | 1.43E-08mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | IKRAQGBWVLSVKL-UHFFFAOYSA-N |
| SMILES | O=C1NCC(COc2ccc(Cl)cc2)O1 |
|
~%
2-Oxazolidinone... CAS#:14716-97-3 |
| Literature: Lunsford,C.D. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 1166 - 1171 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(4-chlorophenoxymethyl)-2-oxazolidinone |
| HMS1788E05 |
| HMS2665L18 |
| 5-(4-chloro-phenoxymethyl)-oxazolidin-2-one |
| 5-(p-Chlorphenoxy)-methyl-2-oxazolidon |