3-Hydroxy-5-(4-chlorophenyl)isoxazole
Modify Date: 2025-08-30 11:36:05
3-Hydroxy-5-(4-chlorophenyl)isoxazole structure
|
Common Name | 3-Hydroxy-5-(4-chlorophenyl)isoxazole | ||
|---|---|---|---|---|
| CAS Number | 14723-58-1 | Molecular Weight | 195.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Hydroxy-5-(4-chlorophenyl)isoxazole |
|---|
| Molecular Formula | C9H6ClNO2 |
|---|---|
| Molecular Weight | 195.60 |
| InChIKey | DLYXFWMNCVTAMQ-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc(Cl)cc2)o[nH]1 |
|
Name: Anthelmintic activity against Nippostrongylus brasiliensisin in parasitized albino ra...
Source: ChEMBL
Target: Nippostrongylus brasiliensis
External Id: CHEMBL3280592
|
|
Name: Inhibition of human Notum (S81-T451 residues) C330S mutant expressed in HEK293S cells...
Source: ChEMBL
Target: Palmitoleoyl-protein carboxylesterase NOTUM
External Id: CHEMBL4704588
|
Total 2, Current Page 1 of 1
1