Alanine, N-carboxy-,N-benzyl ester, 2-(o-chlorophenyl)hydrazide, L- (8CI) structure
|
Common Name | Alanine, N-carboxy-,N-benzyl ester, 2-(o-chlorophenyl)hydrazide, L- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 14723-81-0 | Molecular Weight | 347.79600 | |
| Density | 1.306g/cm3 | Boiling Point | 487.4ºC at 760 mmHg | |
| Molecular Formula | C17H18ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.5ºC | |
| Name | benzyl N-[1-[2-(2-chlorophenyl)hydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 487.4ºC at 760 mmHg |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.79600 |
| Flash Point | 248.5ºC |
| Exact Mass | 347.10400 |
| PSA | 79.46000 |
| LogP | 3.95280 |
| Vapour Pressure | 1.19E-09mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | JUEDRCAMWYQAKS-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NNc1ccccc1Cl |
|
~%
Alanine, N-carb... CAS#:14723-81-0 |
| Literature: Milne,H.B.; Most,C.F. Journal of Organic Chemistry, 1968 , vol. 33, # 1 p. 169 - 175 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-Benzyloxycarbonyl-L-alanin-o-chlor-phenylhydrazid |
| benzyl{1-[2-(2-chlorophenyl)hydrazinyl]-1-oxopropan-2-yl}carbamate(non-preferred name) |