5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecane-1,2-diol structure
|
Common Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 147274-18-8 | Molecular Weight | 408.15700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9F13O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9F13O2 |
|---|---|
| Molecular Weight | 408.15700 |
| Exact Mass | 408.03900 |
| PSA | 40.46000 |
| LogP | 3.85860 |
| InChIKey | UAEMJXPBHSWBQB-UHFFFAOYSA-N |
| SMILES | OCC(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
~90%
5,5,6,6,7,7,8,8... CAS#:147274-18-8 |
| Literature: Cirkva, Vladimir; Boehm, Stanislav; Paleta, Oldrich Journal of Fluorine Chemistry, 2000 , vol. 102, # 1-2 p. 159 - 168 |
|
~%
5,5,6,6,7,7,8,8... CAS#:147274-18-8 |
| Literature: Cirkva, Vladimir; Boehm, Stanislav; Paleta, Oldrich Journal of Fluorine Chemistry, 2000 , vol. 102, # 1-2 p. 159 - 168 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2-Decanediol,5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro |