Ethyl 2-(3-acetamido-2-oxopyridin-1-yl)acetate
Modify Date: 2026-07-06 13:36:13
Ethyl 2-(3-acetamido-2-oxopyridin-1-yl)acetate structure
|
Common Name | Ethyl 2-(3-acetamido-2-oxopyridin-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 147283-75-8 | Molecular Weight | 238.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-(3-acetamido-2-oxopyridin-1-yl)acetate |
|---|
| Molecular Formula | C11H14N2O4 |
|---|---|
| Molecular Weight | 238.24 |
| InChIKey | CTPNXSKPIOSRLA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cn1cccc(NC(C)=O)c1=O |
|
Name: Inhibition of rabbit muscle glycogen phosphorylase at 222 uM
Source: ChEMBL
Target: Glycogen phosphorylase, muscle form
External Id: CHEMBL1060537
|
Total 1, Current Page 1 of 1
1