5-[(4-FLUOROPHENYL)AMINO]-1,3,4-THIADIAZOLE-2-THIOL structure
|
Common Name | 5-[(4-FLUOROPHENYL)AMINO]-1,3,4-THIADIAZOLE-2-THIOL | ||
|---|---|---|---|---|
| CAS Number | 14731-24-9 | Molecular Weight | 227.28200 | |
| Density | 1.57g/cm3 | Boiling Point | 316.1ºC at 760mmHg | |
| Molecular Formula | C8H6FN3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.9ºC | |
| Name | 5-(4-fluoroanilino)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 316.1ºC at 760mmHg |
| Molecular Formula | C8H6FN3S2 |
| Molecular Weight | 227.28200 |
| Flash Point | 144.9ºC |
| Exact Mass | 226.99900 |
| PSA | 104.85000 |
| LogP | 2.78250 |
| Vapour Pressure | 0.000421mmHg at 25°C |
| Index of Refraction | 1.742 |
| InChIKey | WIIOPIYGNZKALU-UHFFFAOYSA-N |
| SMILES | Fc1ccc(Nc2n[nH]c(=S)s2)cc1 |
|
~%
5-[(4-FLUOROPHE... CAS#:14731-24-9 |
| Literature: Giri,S.; Singh,H. Journal of the Indian Chemical Society, 1967 , vol. 44, # 2 p. 145 - 147 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|
| 5-[(4-fluorophenyl)amino]-1,3,4-thiadiazole-2-thiol |
| 2-(4-Fluor-phenylamino)-5-mercapto-<1,3,4>thiadiazol |
| 5-(4-fluoro-anilino)-3H-[1,3,4]thiadiazole-2-thione |