6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine]
Modify Date: 2025-10-21 20:32:45
![6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine] Structure](https://www.chemsrc.com/extcaspic/212/147372-98-3.png)
6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine] structure
|
Common Name | 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine] | ||
|---|---|---|---|---|
| CAS Number | 147372-98-3 | Molecular Weight | 231.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21NO |
|---|---|
| Molecular Weight | 231.33 |
| InChIKey | YDKXYUWDKJPHIA-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc2c(c1)C1(CCNCC1)OC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 147372-98-3? |
| A: Chinese name of 147372-98-3 is 147372-98-3. |
| Q: What is the CAS number of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine]? |
| A: CAS number of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine] is 147372-98-3. |
| Q: What is the InChIKey of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine]? |
| A: InChIKey of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine] is YDKXYUWDKJPHIA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine]? |
| A: SMILES notation of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine] is CC(C)c1ccc2c(c1)C1(CCNCC1)OC2. |
| Q: What is the molecular formula of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine]? |
| A: Molecular formula of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine] is C15H21NO. |
| Q: What is the molecular weight of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine]? |
| A: Molecular weight of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine] is 231.33. |
| Q: What is the English name of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine]? |
| A: The English name of 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine] is 6-(1-Methylethyl)spiro[isobenzofuran-1(3H),4a(2)-piperidine]. |