(3R,5R,6S,8R,9S,10R,13S,14S)-3,6-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one structure
|
Common Name | (3R,5R,6S,8R,9S,10R,13S,14S)-3,6-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one | ||
|---|---|---|---|---|
| CAS Number | 1474-72-2 | Molecular Weight | 306.44000 | |
| Density | 1.158g/cm3 | Boiling Point | 454.7ºC at 760 mmHg | |
| Molecular Formula | C19H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.9ºC | |
| Name | (3R,5R,6S,8R,9S,10R,13S,14S)-3,6-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 454.7ºC at 760 mmHg |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.44000 |
| Flash Point | 242.9ºC |
| Exact Mass | 306.21900 |
| PSA | 57.53000 |
| LogP | 2.92990 |
| Vapour Pressure | 3.51E-10mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | ACXNWFRSEGWJGF-COEUBBBCSA-N |
| SMILES | CC12CCC3C(CC(O)C4CC(O)CCC43C)C1CCC2=O |
|
~%
(3R,5R,6S,8R,9S... CAS#:1474-72-2 |
| Literature: Hodosan,F. et al. Chemische Berichte, 1962 , vol. 95, p. 1094 - 1097 |
|
~%
(3R,5R,6S,8R,9S... CAS#:1474-72-2 |
| Literature: Parke,Davis and Co. Patent: US2337563 , 1940 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Fujianmycin A |