Meletimide structure
|
Common Name | Meletimide | ||
|---|---|---|---|---|
| CAS Number | 14745-50-7 | Molecular Weight | 376.49100 | |
| Density | 1.162g/cm3 | Boiling Point | 555.6ºC at 760mmHg | |
| Molecular Formula | C24H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.8ºC | |
| Name | 3-[1-[(4-methylphenyl)methyl]piperidin-4-yl]-3-phenylpiperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 555.6ºC at 760mmHg |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.49100 |
| Flash Point | 289.8ºC |
| Exact Mass | 376.21500 |
| PSA | 52.90000 |
| LogP | 3.79540 |
| Index of Refraction | 1.592 |
| InChIKey | YFBSRLFXFGHCCG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CN2CCC(C3(c4ccccc4)CCC(=O)NC3=O)CC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Meletimidum |
| Meletimide |
| Meletimida |
| UNII-NZP1W4BK07 |
| METHYLDIOXATRINE |