ethyl 4-[(1-oxoallyl)amino]benzoate structure
|
Common Name | ethyl 4-[(1-oxoallyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 14745-58-5 | Molecular Weight | 219.23700 | |
| Density | 1.162g/cm3 | Boiling Point | 395.4ºC at 760mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.9ºC | |
| Name | ethyl 4-(prop-2-enoylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 395.4ºC at 760mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 192.9ºC |
| Exact Mass | 219.09000 |
| PSA | 55.40000 |
| LogP | 2.06080 |
| Vapour Pressure | 1.84E-06mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | WPLURKJQMNROKG-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Nc1ccc(C(=O)OCC)cc1 |
| HS Code | 2924299090 |
|---|
|
~76%
ethyl 4-[(1-oxo... CAS#:14745-58-5 |
| Literature: Fick, David B.; Foreman, Mark M.; Glasky, Alvin J. Patent: US2002/156277 A1, 2002 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acrylsaeure-<4-aethoxycarbonyl-anilid> |
| 4-Acryloylamino-benzoesaeure-aethylester |
| 4-acryloylaminobenzoic acid ethyl ester |