Ac-Gly-Lys-OMe
Ac-Gly-Lys-OMe structure
|
Common Name | Ac-Gly-Lys-OMe | ||
|---|---|---|---|---|
| CAS Number | 14752-92-2 | Molecular Weight | 319.35400 | |
| Density | 1.129g/cm3 | Boiling Point | 509.4ºC at 760mmHg | |
| Molecular Formula | C13H25N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | n-acetyl-gly-lys methyl ester acetate salt |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 509.4ºC at 760mmHg |
| Molecular Formula | C13H25N3O6 |
| Molecular Weight | 319.35400 |
| Flash Point | 261.9ºC |
| Exact Mass | 319.17400 |
| PSA | 147.82000 |
| LogP | 0.48230 |
| Vapour Pressure | 6.19E-11mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | UNWQLIOZIACTGA-FVGYRXGTSA-N |
| SMILES | CC(=O)O.COC(=O)C(CCCCN)NC(=O)CNC(C)=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| WGK Germany | 3 |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| AGLME ACETATE SALT |
| AC-GLY-LYS-OME ACOH |
| Einecs 238-814-5 |
| ACETYLGLYCYL-L-LYSINE METHYL ESTER ACOH |
| AC-GLY-LYS-OME ACETATE SALT |
| N-acetyl-gly-lys methyl ester acetate |
| AGLME |
| Ac-Gly-Lys-OMe |
| AGLME ACOH |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of n-acetyl-gly-lys methyl ester acetate salt? |
| A: CAS number of n-acetyl-gly-lys methyl ester acetate salt is 14752-92-2. |
| Q: What is the LogP of n-acetyl-gly-lys methyl ester acetate salt? |
| A: LogP of n-acetyl-gly-lys methyl ester acetate salt is 0.48230. |
| Q: What is the molecular weight of n-acetyl-gly-lys methyl ester acetate salt? |
| A: Molecular weight of n-acetyl-gly-lys methyl ester acetate salt is 319.35400. |
| Q: What is the polar surface area (PSA) of n-acetyl-gly-lys methyl ester acetate salt? |
| A: Polar surface area (PSA) of n-acetyl-gly-lys methyl ester acetate salt is 147.82000. |
| Q: What is the InChIKey of n-acetyl-gly-lys methyl ester acetate salt? |
| A: InChIKey of n-acetyl-gly-lys methyl ester acetate salt is UNWQLIOZIACTGA-FVGYRXGTSA-N. |
| Q: What is the molecular formula of n-acetyl-gly-lys methyl ester acetate salt? |
| A: Molecular formula of n-acetyl-gly-lys methyl ester acetate salt is C13H25N3O6. |
| Q: What is the English name of n-acetyl-gly-lys methyl ester acetate salt? |
| A: The English name of n-acetyl-gly-lys methyl ester acetate salt is n-acetyl-gly-lys methyl ester acetate salt. |
| Q: What is the SMILES notation of n-acetyl-gly-lys methyl ester acetate salt? |
| A: SMILES notation of n-acetyl-gly-lys methyl ester acetate salt is CC(=O)O.COC(=O)C(CCCCN)NC(=O)CNC(C)=O. |
| Q: What English synonyms does n-acetyl-gly-lys methyl ester acetate salt have? |
| A: English synonyms of n-acetyl-gly-lys methyl ester acetate salt: AGLME ACETATE SALT, AC-GLY-LYS-OME ACOH, Einecs 238-814-5, ACETYLGLYCYL-L-LYSINE METHYL ESTER ACOH, AC-GLY-LYS-OME ACETATE SALT, N-acetyl-gly-lys methyl ester acetate, AGLME, Ac-Gly-Lys-OMe, AGLME ACOH. |
| Q: What is the Chinese name of 14752-92-2? |
| A: Chinese name of 14752-92-2 is AC-GLY-LYS-OME. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |