7-Methyl-4-nitroquinoline 1-oxide structure
|
Common Name | 7-Methyl-4-nitroquinoline 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 14753-13-0 | Molecular Weight | 204.18200 | |
| Density | 1.36g/cm3 | Boiling Point | 397.5ºC at 760mmHg | |
| Molecular Formula | C10H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.2ºC | |
| Name | 7-methyl-4-nitro-1-oxidoquinolin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 397.5ºC at 760mmHg |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18200 |
| Flash Point | 194.2ºC |
| Exact Mass | 204.05300 |
| PSA | 71.28000 |
| LogP | 3.00810 |
| Vapour Pressure | 3.63E-06mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | MEQZPIUNLKFFEN-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c([N+](=O)[O-])cc[n+]([O-])c2c1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Quinoline,7-methyl-4-nitro-,1-oxide |
| 7-Methyl-4-nitrochinolin-1-oxid |
| 7-methyl-4-nitroquinoline N-oxide |
| 7-Methyl-4-nitroquinoline 1-oxide |