(2,4,6-trichlorophenyl) N-(oxomethylidene)sulfamate structure
|
Common Name | (2,4,6-trichlorophenyl) N-(oxomethylidene)sulfamate | ||
|---|---|---|---|---|
| CAS Number | 14754-46-2 | Molecular Weight | 302.51900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2Cl3NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4,6-trichlorophenyl) N-(oxomethylidene)sulfamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H2Cl3NO4S |
|---|---|
| Molecular Weight | 302.51900 |
| Exact Mass | 300.87700 |
| PSA | 81.18000 |
| LogP | 3.68700 |
| InChIKey | GGFHWSSFXSFDDS-UHFFFAOYSA-N |
| SMILES | O=C=NS(=O)(=O)Oc1c(Cl)cc(Cl)cc1Cl |
|
~%
(2,4,6-trichlor... CAS#:14754-46-2 |
| Literature: Hedayatullah, Mir; Hugueny, Jean Claude Phosphorus, Sulfur and Silicon and the Related Elements, 1991 , vol. 61, # 1.2. p. 19 - 25 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,4,6-Trichlor-phenoxy-sulfonyl-isocyanat |
| Isocyanatosulfuric acid,2,4,6-trichlorophenyl ester |