3-[2-(Dimethylamino)ethyl]-1H-indol-6-ol structure
|
Common Name | 3-[2-(Dimethylamino)ethyl]-1H-indol-6-ol | ||
|---|---|---|---|---|
| CAS Number | 1476-33-1 | Molecular Weight | 204.26800 | |
| Density | 1.178g/cm3 | Boiling Point | 392.8ºC at 760mmHg | |
| Molecular Formula | C12H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.3ºC | |
| Name | 3-[2-(Dimethylamino)ethyl]-1H-indol-6-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 392.8ºC at 760mmHg |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.26800 |
| Flash Point | 191.3ºC |
| Exact Mass | 204.12600 |
| PSA | 39.26000 |
| LogP | 1.97760 |
| Vapour Pressure | 9.89E-07mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | WUQMRWPLIMXBDX-UHFFFAOYSA-N |
| SMILES | CN(C)CCc1c[nH]c2cc(O)ccc12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
Name: Inhibition constant against human 5-hydroxytryptamine 2C receptor [VGI isoforms] usin...
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 2C
External Id: CHEMBL872136
|
|
Name: Inhibition constant against human 5-hydroxytryptamine 2C receptor [INI isoforms] usin...
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 2C
External Id: CHEMBL872135
|
|
Name: Hallucinogenic activity in human relative to mescaline
Source: ChEMBL
Target: Homo sapiens
External Id: CHEMBL3258806
|
|
Name: Inhibition constant against rat 5-hydroxytryptamine 2C receptor using [3H]mesulergine...
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 2C
External Id: CHEMBL882469
|
|
Name: Inhibition constant against rat 5-hydroxytryptamine 2A receptor using [3H]ketanserin ...
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 2A
External Id: CHEMBL882467
|
|
Name: Inhibition constant against human 5-hydroxytryptamine 2B receptor using [3H]LSD as ra...
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 2B
External Id: CHEMBL882450
|
|
Name: Inhibition constant against human 5-hydroxytryptamine 2A receptor using [3H]ketanseri...
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 2A
External Id: CHEMBL882471
|
| 6-Hydroxy-dimethyltryptamin |
| 6-Hydroxy-N,N-dimethyltryptamin |
| 6-Hydroxy-N,N-dimethyltryptamine |