3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran
Modify Date: 2026-07-08 23:15:21
3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran structure
|
Common Name | 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran | ||
|---|---|---|---|---|
| CAS Number | 1476076-12-6 | Molecular Weight | 219.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13NO3 |
|---|---|
| Molecular Weight | 219.24 |
| InChIKey | SGYAHQJEQHTWHR-UHFFFAOYSA-N |
| SMILES | CC1(C)COc2c(C=C[N+](=O)[O-])cccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1476076-12-6? |
| A: Chinese name of 1476076-12-6 is 1476076-12-6. |
| Q: What is the SMILES notation of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran? |
| A: SMILES notation of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran is CC1(C)COc2c(C=C[N+](=O)[O-])cccc21. |
| Q: What is the molecular formula of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran? |
| A: Molecular formula of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran is C12H13NO3. |
| Q: What is the InChIKey of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran? |
| A: InChIKey of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran is SGYAHQJEQHTWHR-UHFFFAOYSA-N. |
| Q: What is the English name of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran? |
| A: The English name of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran is 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran. |
| Q: What is the CAS number of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran? |
| A: CAS number of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran is 1476076-12-6. |
| Q: What is the molecular weight of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran? |
| A: Molecular weight of 3,3-dimethyl-7-(2-nitrovinyl)-2H-benzofuran is 219.24. |