3-Oxo-3-(4-phenyl-1-piperazinyl)propanenitrile structure
|
Common Name | 3-Oxo-3-(4-phenyl-1-piperazinyl)propanenitrile | ||
|---|---|---|---|---|
| CAS Number | 14761-40-1 | Molecular Weight | 229.278 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 451.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.9±27.3 °C | |
| Name | 3-oxo-3-(4-phenylpiperazin-1-yl)propanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.5±40.0 °C at 760 mmHg |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.278 |
| Flash Point | 226.9±27.3 °C |
| Exact Mass | 229.121506 |
| PSA | 47.34000 |
| LogP | 0.40 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | ALISXWJRKBXOHC-UHFFFAOYSA-N |
| SMILES | N#CCC(=O)N1CCN(c2ccccc2)CC1 |
| HS Code | 2933599090 |
|---|
|
~87%
3-Oxo-3-(4-phen... CAS#:14761-40-1 |
| Literature: Manikowski, Andrzej; Kolarska, Zofia Synthetic Communications, 2009 , vol. 39, # 20 p. 3621 - 3638 |
|
~34%
3-Oxo-3-(4-phen... CAS#:14761-40-1 |
| Literature: Gazit, Aviv; Osherov, Nir; Posner, Israel; Yaish, Pnina; Poradosu, Enrique; et al. Journal of Medicinal Chemistry, 1991 , vol. 34, # 6 p. 1896 - 1907 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| b-Oxo-4-phenyl-1-piperazinepropanenitrile |
| 3-(4-phenylpiperazin-1-yl)-3-oxopropanenitrile |
| 3-Oxo-3-(4-phenyl-1-piperazinyl)propanenitrile |
| 3-oxo-3-(4-phenylpiperazinyl)propanenitrile |
| 1-cyanoacetyl-4-phenyl-piperazine |
| 1-Piperazinepropanenitrile, β-oxo-4-phenyl- |
| 3-Oxo-3-(4-phenyl-piperazin-1-yl)-propionitrile |
| 4-Phenyl-1-cyanoacetylpiperazin |
| 1-piperazinepropanenitrile,|A-oxo-4-phenyl |
| 3-oxo-3-(4-phenylpiperazino)propanenitrile |
| 1-Cyanoacetyl-4-phenyl-piperazin |