10-(2-methoxyethoxymethyl)acridin-9-one
10-(2-methoxyethoxymethyl)acridin-9-one structure
|
Common Name | 10-(2-methoxyethoxymethyl)acridin-9-one | ||
|---|---|---|---|---|
| CAS Number | 147643-41-2 | Molecular Weight | 283.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 10-(2-Methoxyethoxymethyl)acridin-9-one (CAS: 147643-41-2), molecular formula: C17H17NO3, molecular weight: 283.32200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 10-(2-methoxyethoxymethyl)acridin-9-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17NO3 |
|---|---|
| Molecular Weight | 283.32200 |
| Exact Mass | 283.12100 |
| PSA | 40.46000 |
| LogP | 2.77520 |
| InChIKey | GZVAFHHEQOEIHT-UHFFFAOYSA-N |
| SMILES | COCCOCn1c2ccccc2c(=O)c2ccccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~74%
10-(2-methoxyet... CAS#:147643-41-2 |
| Literature: Tanaka, Toshihiro; Tasaki, Takashi; Aoyama, Yasuhiro Journal of the American Chemical Society, 2002 , vol. 124, # 42 p. 12453 - 12462 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-methoxyethoxymethyl-9-acridone |
| 10-methoxyethoxymethyl-9-acridone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 10-(2-methoxyethoxymethyl)acridin-9-one have? |
| A: English synonyms of 10-(2-methoxyethoxymethyl)acridin-9-one: N-methoxyethoxymethyl-9-acridone, 10-methoxyethoxymethyl-9-acridone. |
| Q: What is the InChIKey of 10-(2-methoxyethoxymethyl)acridin-9-one? |
| A: InChIKey of 10-(2-methoxyethoxymethyl)acridin-9-one is GZVAFHHEQOEIHT-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 10-(2-methoxyethoxymethyl)acridin-9-one? |
| A: Molecular weight of 10-(2-methoxyethoxymethyl)acridin-9-one is 283.32200. |
| Q: What is the molecular formula of 10-(2-methoxyethoxymethyl)acridin-9-one? |
| A: Molecular formula of 10-(2-methoxyethoxymethyl)acridin-9-one is C17H17NO3. |
| Q: What is the CAS number of 10-(2-methoxyethoxymethyl)acridin-9-one? |
| A: CAS number of 10-(2-methoxyethoxymethyl)acridin-9-one is 147643-41-2. |
| Q: What is the polar surface area (PSA) of 10-(2-methoxyethoxymethyl)acridin-9-one? |
| A: Polar surface area (PSA) of 10-(2-methoxyethoxymethyl)acridin-9-one is 40.46000. |
| Q: What are the upstream materials of 10-(2-methoxyethoxymethyl)acridin-9-one? |
| A: Related upstream materials(CAS) of 10-(2-methoxyethoxymethyl)acridin-9-one: 3970-21-6;578-95-0. |
| Q: What is the SMILES notation of 10-(2-methoxyethoxymethyl)acridin-9-one? |
| A: SMILES notation of 10-(2-methoxyethoxymethyl)acridin-9-one is COCCOCn1c2ccccc2c(=O)c2ccccc21. |
| Q: What is the Chinese name of 147643-41-2? |
| A: Chinese name of 147643-41-2 is 147643-41-2. |
| Q: What is the LogP of 10-(2-methoxyethoxymethyl)acridin-9-one? |
| A: LogP of 10-(2-methoxyethoxymethyl)acridin-9-one is 2.77520. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |