N'-(p-Fluoro-α-methylbenzyl)carbazic acid ethyl ester structure
|
Common Name | N'-(p-Fluoro-α-methylbenzyl)carbazic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1478-87-1 | Molecular Weight | 226.24700 | |
| Density | 1.143g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H15FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[1-(4-fluorophenyl)ethylamino]carbamate |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.24700 |
| Exact Mass | 226.11200 |
| PSA | 53.85000 |
| LogP | 2.73270 |
| Index of Refraction | 1.504 |
| InChIKey | DTQYCFWSXJGCRW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NNC(C)c1ccc(F)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |