(R)-(-)-Repaglinide (Repaglinide Impurity) structure
|
Common Name | (R)-(-)-Repaglinide (Repaglinide Impurity) | ||
|---|---|---|---|---|
| CAS Number | 147852-26-4 | Molecular Weight | 452.58600 | |
| Density | 1.138g/cm3 | Boiling Point | 672.938ºC at 760 mmHg | |
| Molecular Formula | C27H36N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.78ºC | |
Use of (R)-(-)-Repaglinide (Repaglinide Impurity)Repaglinide, (-)-, is a Repaglinide impurity where only the R-enantiomer showed weak hypoglycemic activity. |
| Name | 2-ethoxy-4-[2-[[(1R)-3-methyl-1-(2-piperidin-1-ylphenyl)butyl]amino]-2-oxoethyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 672.938ºC at 760 mmHg |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.58600 |
| Flash Point | 360.78ºC |
| Exact Mass | 452.26800 |
| PSA | 82.36000 |
| LogP | 6.12520 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | FAEKWTJYAYMJKF-HSZRJFAPSA-N |
| SMILES | CCOc1cc(CC(=O)NC(CC(C)C)c2ccccc2N2CCCCC2)ccc1C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|
| AG-EE 624ZW |
| UNII-85M30X62FM |
| Repaglinide impurity E |