LHRH (lamprey III) trifluoroacetate salt structure
|
Common Name | LHRH (lamprey III) trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 147859-97-0 | Molecular Weight | 1259.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C59H74N18O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LHRH (lamprey III) trifluoroacetate saltLGnRH-III, lamprey, an isoform of GnRH isolated from the sea lamprey, is a weak GnRH agonist with antitumor activities[1][2]. |
| Name | (des-gly10,d-ala6,pro-nhet9)-lhrh ii |
|---|---|
| Synonym | More Synonyms |
| Description | LGnRH-III, lamprey, an isoform of GnRH isolated from the sea lamprey, is a weak GnRH agonist with antitumor activities[1][2]. |
|---|---|
| Related Catalog | |
| Target |
GnRH[2] |
| References |
| Molecular Formula | C59H74N18O14 |
|---|---|
| Molecular Weight | 1259.33 |
| Exact Mass | 1258.56000 |
| PSA | 497.79000 |
| LogP | 1.02120 |
| InChIKey | RTASYRSYWSLWJV-CSYZDTNESA-N |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CC(=O)O)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(CO)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1cnc[nH]1)NC(=O)C1CCC(=O)N1)C(=O)N1CCCC1C(=O)NCC(N)=O |
| Petromyson marinus gonadotropin-releasing hormone III |
| Glp-His-Trp-Ser-His-Asp-Trp-Lys-Pro-Gly-NH2 |
| luteinizing hormone-releasing hormone isoform III |
| p-EtO2CC6H4ZnI |
| gonadotropin-releasing hormone III |
| pEHWSHDWKPG-NH2 |