1,2-dichloro-1,1,2,4,4,6,6-heptafluoro-6-iodohexane structure
|
Common Name | 1,2-dichloro-1,1,2,4,4,6,6-heptafluoro-6-iodohexane | ||
|---|---|---|---|---|
| CAS Number | 1479-17-0 | Molecular Weight | 406.89500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4Cl2F7I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-dichloro-1,1,2,4,4,6,6-heptafluoro-6-iodohexane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4Cl2F7I |
|---|---|
| Molecular Weight | 406.89500 |
| Exact Mass | 405.86200 |
| LogP | 5.16590 |
| InChIKey | PKSWWHBIALPZGB-UHFFFAOYSA-N |
| SMILES | FC(F)(I)CC(F)(F)CC(F)(Cl)C(F)(F)Cl |
|
~%
1,2-dichloro-1,... CAS#:1479-17-0 |
| Literature: Hauptschein et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 846,847 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2-dichloro-1,1,2,4,4,6,6-heptafluoro-6-iodo-hexane |
| 1,2-Dichlor-1,1,2,4,4,6,6-heptafluor-6-jod-hexan |
| Hexane,1,2-dichloro-1,1,2,4,4,6,6-heptafluoro-6-iodo |