Hydrazinecarboxamide,2,2',2''-phosphinylidynetris- (9CI)
Modify Date: 2025-11-08 13:33:50
Hydrazinecarboxamide,2,2',2''-phosphinylidynetris- (9CI) structure
|
Common Name | Hydrazinecarboxamide,2,2',2''-phosphinylidynetris- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 14795-54-1 | Molecular Weight | 269.15900 | |
| Density | 1.709g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C3H12N9O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-3-bis(hydrazinecarbonylamino)phosphorylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.709g/cm3 |
|---|---|
| Molecular Formula | C3H12N9O4P |
| Molecular Weight | 269.15900 |
| Exact Mass | 269.07500 |
| PSA | 228.33000 |
| LogP | 1.05950 |
| Index of Refraction | 1.616 |
| InChIKey | SIAAKBMRNYIHJY-UHFFFAOYSA-N |
| SMILES | NNC(=O)NP(=O)(NC(=O)NN)NC(=O)NN |
|
~%
Hydrazinecarbox... CAS#:14795-54-1 |
| Literature: Cates Journal of medicinal chemistry, 1967 , vol. 10, # 5 p. 924 - 927 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| n,n',n''-phosphoryltrihydrazinecarboxamide |