Benzenesulfonic acid,5-amino-2-[(2-methoxyphenyl)amino]- structure
|
Common Name | Benzenesulfonic acid,5-amino-2-[(2-methoxyphenyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 148-54-9 | Molecular Weight | 294.32600 | |
| Density | 1.439g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-amino-2-(2-methoxyanilino)benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.32600 |
| Exact Mass | 294.06700 |
| PSA | 110.03000 |
| LogP | 4.00270 |
| Index of Refraction | 1.659 |
| InChIKey | KWQMSQIIPCKLHJ-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Nc1ccc(N)cc1S(=O)(=O)O |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Amino-2-o-anisidino-benzolsulfonsaeure |
| EINECS 205-716-9 |
| 5-amino-2-o-anisidino-benzenesulfonic acid |