4(3H)-Pyrimidinethione,5-amino-2-chloro-6-(trifluoromethyl)- structure
|
Common Name | 4(3H)-Pyrimidinethione,5-amino-2-chloro-6-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1480-67-7 | Molecular Weight | 229.61100 | |
| Density | 1.86g/cm3 | Boiling Point | 210.6ºC at 760 mmHg | |
| Molecular Formula | C5H3ClF3N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.1ºC | |
| Name | 5-amino-2-chloro-6-(trifluoromethyl)-1H-pyrimidine-4-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.86g/cm3 |
|---|---|
| Boiling Point | 210.6ºC at 760 mmHg |
| Molecular Formula | C5H3ClF3N3S |
| Molecular Weight | 229.61100 |
| Flash Point | 81.1ºC |
| Exact Mass | 228.96900 |
| PSA | 86.79000 |
| LogP | 2.97480 |
| Vapour Pressure | 0.191mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | XUIZNYGUGHXUJI-UHFFFAOYSA-N |
| SMILES | Nc1c(C(F)(F)F)[nH]c(Cl)nc1=S |
| HS Code | 2933599090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chlor-5-amino-4-mercapto-6-trifluormethyl-pyrimidin |
| 5-amino-2-chloro-6-trifluoromethyl-3H-pyrimidine-4-thione |