Mono-2-ethylhexyl (2-Ethylhexyl)phosphonate structure
|
Common Name | Mono-2-ethylhexyl (2-Ethylhexyl)phosphonate | ||
|---|---|---|---|---|
| CAS Number | 14802-03-0 | Molecular Weight | 306.42100 | |
| Density | 0.953g/cm3 | Boiling Point | 390.6ºC at 760mmHg | |
| Molecular Formula | C16H35O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | 2-ethylhexyl hydrogen -2-ethylhexylphosphonate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.953g/cm3 |
|---|---|
| Boiling Point | 390.6ºC at 760mmHg |
| Molecular Formula | C16H35O3P |
| Molecular Weight | 306.42100 |
| Flash Point | 190ºC |
| Exact Mass | 306.23200 |
| PSA | 56.34000 |
| LogP | 5.62120 |
| Vapour Pressure | 3.46E-07mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | ZDFBXXSHBTVQMB-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COP(=O)(O)CC(CC)CCCC |
| RIDADR | UN 3265 |
|---|---|
| Packaging Group | III |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| PHOSPHONIC ACID (2-ETHYLHEXYL)-MONO(2-ETHLHEXYL)ESTER |
| PC-88A |
| mono(2-ethylhexyl) 2-ethylhexylphosphonate |
| 2-Ethyl hexylphosphic mono-2-ethylhexyl ester |
| 2-Ethylhexylphosphoric Acid Mono-2-Ethylhexyl Ester |
| Einecs 238-865-3 |
| (2-Ethyl-hexyl)-phosphonsaeure-(2-ethyl-hexyl)-monoester |
| 2-ethylhexyl hydrogen 2-ethylhexylphosphonate |
| 2-Ethyl-hexyl-phosphonsaeure-mono-(2-ethyl-hexylester) |
| (2-ethylhexyl)-phosphonic aci mono(2-ethylhexyl) ester |
| 2-ethylhexyl 2-ethylhexyl phosphonic acid |
| (2-ethylhexyl)phosphonic acid mono(2-ethylhexyl) ester |
| 2-ethyl hexylphosphonate mono-2-ethyl hexylester |