Factor B-IN-1
Modify Date: 2025-08-26 17:16:43
Factor B-IN-1 structure
|
Common Name | Factor B-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 1481631-75-7 | Molecular Weight | 332.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Factor B-IN-1Factor B-IN-1 is a Factor B inhibitor extracted from patent WO2013164802A1, Example 24[1]. |
| Name | Factor B-IN-1 |
|---|
| Description | Factor B-IN-1 is a Factor B inhibitor extracted from patent WO2013164802A1, Example 24[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Christopher Michael Adams, et al. Complement pathway modulators and uses thereof. WO2013164802A1. |
| Molecular Formula | C19H16N4O2 |
|---|---|
| Molecular Weight | 332.36 |
| InChIKey | IAUVRHDNBNIFFB-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c2[nH]ccc2c1C(O)c1nc2ccc(C#N)cc2[nH]1 |