4-(3-Bromophenyl)-2,6-dichloropyrimidine
Modify Date: 2026-08-11 12:12:46
4-(3-Bromophenyl)-2,6-dichloropyrimidine structure
|
Common Name | 4-(3-Bromophenyl)-2,6-dichloropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 1482575-55-2 | Molecular Weight | 303.97 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5BrCl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(3-Bromophenyl)-2,6-dichloropyrimidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H5BrCl2N2 |
|---|---|
| Molecular Weight | 303.97 |
| InChIKey | BYZHDVJJUARQJD-UHFFFAOYSA-N |
| SMILES | Clc1cc(-c2cccc(Br)c2)nc(Cl)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-(3-Bromophenyl)-2,6-dichloropyrimidine? |
| A: SMILES notation of 4-(3-Bromophenyl)-2,6-dichloropyrimidine is Clc1cc(-c2cccc(Br)c2)nc(Cl)n1. |
| Q: What is the English name of 4-(3-Bromophenyl)-2,6-dichloropyrimidine? |
| A: The English name of 4-(3-Bromophenyl)-2,6-dichloropyrimidine is 4-(3-Bromophenyl)-2,6-dichloropyrimidine. |
| Q: What is the InChIKey of 4-(3-Bromophenyl)-2,6-dichloropyrimidine? |
| A: InChIKey of 4-(3-Bromophenyl)-2,6-dichloropyrimidine is BYZHDVJJUARQJD-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-(3-Bromophenyl)-2,6-dichloropyrimidine? |
| A: CAS number of 4-(3-Bromophenyl)-2,6-dichloropyrimidine is 1482575-55-2. |
| Q: What is the molecular formula of 4-(3-Bromophenyl)-2,6-dichloropyrimidine? |
| A: Molecular formula of 4-(3-Bromophenyl)-2,6-dichloropyrimidine is C10H5BrCl2N2. |
| Q: What is the Chinese name of 1482575-55-2? |
| A: Chinese name of 1482575-55-2 is 1482575-55-2. |
| Q: What is the molecular weight of 4-(3-Bromophenyl)-2,6-dichloropyrimidine? |
| A: Molecular weight of 4-(3-Bromophenyl)-2,6-dichloropyrimidine is 303.97. |