1H-Benzimidazole,2-methyl-1-phenyl-, 3-oxide structure
|
Common Name | 1H-Benzimidazole,2-methyl-1-phenyl-, 3-oxide | ||
|---|---|---|---|---|
| CAS Number | 1484-41-9 | Molecular Weight | 224.25800 | |
| Density | 1.17g/cm3 | Boiling Point | 422.2ºC at 760mmHg | |
| Molecular Formula | C14H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.2ºC | |
| Name | 2-methyl-1-oxido-3-phenylbenzimidazol-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 422.2ºC at 760mmHg |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.25800 |
| Flash Point | 209.2ºC |
| Exact Mass | 224.09500 |
| PSA | 30.39000 |
| LogP | 3.36740 |
| Vapour Pressure | 2.45E-07mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | AXFQKEWZNVDKNO-UHFFFAOYSA-N |
| SMILES | Cc1n(-c2ccccc2)c2ccccc2[n+]1[O-] |
|
~68%
1H-Benzimidazol... CAS#:1484-41-9
Learn More
|
| Literature: Alberti, Angelo; Carloni, Patricia; Greci, Lucedio; Stipa, Pierluigi; Andruzzi, Romano; et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1991 , # 7 p. 1019 - 1023 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Methyl-3-Phenylbenzimidazol-1-Oxid |
| 2-METHYL-1-PHENYL-1H-BENZIMIDAZOLE,3-OXIDE |
| 2-methyl-1-phenyl-1H-benzoimidazole 3-oxide |
| 1-Phenyl-2-methylbenzimidazol-3-oxid |