1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthol structure
|
Common Name | 1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthol | ||
|---|---|---|---|---|
| CAS Number | 14847-54-2 | Molecular Weight | 309.27600 | |
| Density | 1.44g/cm3 | Boiling Point | 511.7ºC at 760mmHg | |
| Molecular Formula | C16H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.3ºC | |
| Name | (1Z)-1-[(2-hydroxy-5-nitrophenyl)hydrazinylidene]naphthalen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 511.7ºC at 760mmHg |
| Molecular Formula | C16H11N3O4 |
| Molecular Weight | 309.27600 |
| Flash Point | 263.3ºC |
| Exact Mass | 309.07500 |
| PSA | 107.51000 |
| LogP | 3.30870 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | JCELUWDKTLANOY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c(N=Nc2c(O)ccc3ccccc23)c1 |
| HS Code | 2927000090 |
|---|
|
~%
1-[(2-hydroxy-5... CAS#:14847-54-2 |
| Literature: Satam, Manjaree A.; Sekar, N.; Raut, Rajesh K. Dyes and Pigments, 2013 , vol. 96, # 1 p. 92 - 103,12 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| einecs 238-908-6 |