4-azidobenzoyl chloride structure
|
Common Name | 4-azidobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 14848-01-2 | Molecular Weight | 181.57900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-azidobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4ClN3O |
|---|---|
| Molecular Weight | 181.57900 |
| Exact Mass | 181.00400 |
| PSA | 66.82000 |
| LogP | 2.46016 |
| InChIKey | XXKYTTAVNYTVFC-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)Cl)cc1 |
| HS Code | 2929909090 |
|---|
|
~96%
4-azidobenzoyl ... CAS#:14848-01-2 |
| Literature: ASTRAZENECA AB Patent: US2008/262064 A1, 2008 ; Location in patent: Page/Page column 6; 12 ; US 20080262064 A1 |
|
~%
4-azidobenzoyl ... CAS#:14848-01-2 |
| Literature: Shields, Charles J.; Falvey, Daniel E.; Schuster, Gary B.; Buchardt, Ole; Nielsen, Peter E. Journal of Organic Chemistry, 1988 , vol. 53, # 15 p. 3501 - 3507 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Azido-benzoyl chloride |
| EINECS 238-910-7 |
| 4-azido-benzoic acid chloride |
| 4-Azidobenzoylchlorid |
| Benzoyl chloride,4-azido |
| p-azidobenzoyl chloride |
| p-azidobenzoic acid chloride |