PhotoClick Cholesterol
Modify Date: 2026-08-23 23:09:44
PhotoClick Cholesterol structure
|
Common Name | PhotoClick Cholesterol | ||
|---|---|---|---|---|
| CAS Number | 1485490-47-8 | Molecular Weight | 482.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H46N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | PhotoClick Cholesterol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H46N2O3 |
|---|---|
| Molecular Weight | 482.7 |
| InChIKey | ZJMZIZZWLLQHJO-FNSUTPKXSA-N |
| SMILES | C#CCCCCOC(=O)CCC(C)C1CCC2C3CC4(N=N4)C4CC(O)CCC4(C)C3CCC12C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of PhotoClick Cholesterol? |
| A: The English name of PhotoClick Cholesterol is PhotoClick Cholesterol. |
| Q: What is the Chinese name of 1485490-47-8? |
| A: Chinese name of 1485490-47-8 is 1485490-47-8. |
| Q: What is the SMILES notation of PhotoClick Cholesterol? |
| A: SMILES notation of PhotoClick Cholesterol is C#CCCCCOC(=O)CCC(C)C1CCC2C3CC4(N=N4)C4CC(O)CCC4(C)C3CCC12C. |
| Q: What is the CAS number of PhotoClick Cholesterol? |
| A: CAS number of PhotoClick Cholesterol is 1485490-47-8. |
| Q: What is the InChIKey of PhotoClick Cholesterol? |
| A: InChIKey of PhotoClick Cholesterol is ZJMZIZZWLLQHJO-FNSUTPKXSA-N. |
| Q: What is the molecular weight of PhotoClick Cholesterol? |
| A: Molecular weight of PhotoClick Cholesterol is 482.7. |
| Q: What is the molecular formula of PhotoClick Cholesterol? |
| A: Molecular formula of PhotoClick Cholesterol is C30H46N2O3. |