1-Phenanthrenecarboxylicacid, 5,6,7,8-tetrahydro-10-nitro- structure
|
Common Name | 1-Phenanthrenecarboxylicacid, 5,6,7,8-tetrahydro-10-nitro- | ||
|---|---|---|---|---|
| CAS Number | 14861-12-2 | Molecular Weight | 271.26800 | |
| Density | 1.392g/cm3 | Boiling Point | 508.9ºC at 760 mmHg | |
| Molecular Formula | C15H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.6ºC | |
| Name | 10-nitro-5,6,7,8-tetrahydrophenanthrene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 508.9ºC at 760 mmHg |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.26800 |
| Flash Point | 215.6ºC |
| Exact Mass | 271.08400 |
| PSA | 83.12000 |
| LogP | 3.84820 |
| Vapour Pressure | 3.51E-11mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | IXLLAVBUXBNIQK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2c3c(cc([N+](=O)[O-])c12)CCCC3 |
| HS Code | 2916399090 |
|---|
|
~%
1-Phenanthrenec... CAS#:14861-12-2 |
| Literature: Kupchan,S.M.; Mokotoff,M. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 977 - 979 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 9-Nitro-1,2,3,4-tetrahydrophenanthrene-8-carboxylic acid |