5-Chloro-4-methyl-3-nitro-2-pyridinamine structure
|
Common Name | 5-Chloro-4-methyl-3-nitro-2-pyridinamine | ||
|---|---|---|---|---|
| CAS Number | 148612-17-3 | Molecular Weight | 187.584 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 315.5±37.0 °C at 760 mmHg | |
| Molecular Formula | C6H6ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.6±26.5 °C | |
| Name | 5-chloro-4-methyl-3-nitropyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 315.5±37.0 °C at 760 mmHg |
| Molecular Formula | C6H6ClN3O2 |
| Molecular Weight | 187.584 |
| Flash Point | 144.6±26.5 °C |
| Exact Mass | 187.014847 |
| PSA | 84.73000 |
| LogP | 3.24 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | LLWKTQALVZANCU-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)cnc(N)c1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~73%
5-Chloro-4-meth... CAS#:148612-17-3 |
| Literature: AVENTIS AGRICULTURE; MERIAL LIMITED; Soll, Mark David; Le Hir de Fallois, Loic Patrick; Huber, Scot Kevin; Lee, Hyoung Ik; Wilkinson, Douglas Edward; Jacobs, Robert Toms Patent: US2014/80862 A1, 2014 ; Location in patent: Paragraph 0749 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Chloro-4-methyl-3-nitropyridin-2-amine |
| 2-Amino-5-chloro-3-nitro-4-picoline |
| 5-Chloro-4-methyl-3-nitro-2-pyridinamine |
| 2-amino-3-nitro-4-methyl-5-chloro-pyridine |
| 2-Pyridinamine, 5-chloro-4-methyl-3-nitro- |
| 5-chloro-4-methyl-3-nitro-pyridin-2-ylamine |
| 2-AMINO-3-NITRO-5-CHLORO-4-METHYL PYRIDINE |
| 2-Amino-5-chloro-4-methyl-3-nitropyridine |