5-[2-(Diethylamino)ethyl]-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one structure
|
Common Name | 5-[2-(Diethylamino)ethyl]-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one | ||
|---|---|---|---|---|
| CAS Number | 14870-41-8 | Molecular Weight | 309.40500 | |
| Density | 1.111g/cm3 | Boiling Point | 398.9ºC at 760mmHg | |
| Molecular Formula | C19H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.1ºC | |
| Name | 11-[2-(diethylamino)ethyl]-5H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 398.9ºC at 760mmHg |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.40500 |
| Flash Point | 195.1ºC |
| Exact Mass | 309.18400 |
| PSA | 39.07000 |
| LogP | 3.61680 |
| Vapour Pressure | 1.42E-06mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | AMORDSNWJXKHMV-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN1c2ccccc2NC(=O)c2ccccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-<2-Diethylamino-ethyl>-11-oxo-10.11-dihydro-5H-dibenzo<b.e><1.4>>diazepin |