1,3,3a,4,7,7-α-Hexahydro-1,3-dimethoxy-4,7-methanoisobenzofuran structure
|
Common Name | 1,3,3a,4,7,7-α-Hexahydro-1,3-dimethoxy-4,7-methanoisobenzofuran | ||
|---|---|---|---|---|
| CAS Number | 14882-64-5 | Molecular Weight | 196.24300 | |
| Density | 1.15g/cm3 | Boiling Point | 265.2ºC at 760mmHg | |
| Molecular Formula | C11H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.3ºC | |
| Name | 1,3,3a,4,7,7-α-Hexahydro-1,3-dimethoxy-4,7-methanoisobenzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 265.2ºC at 760mmHg |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.24300 |
| Flash Point | 87.3ºC |
| Exact Mass | 196.11000 |
| PSA | 27.69000 |
| LogP | 1.39990 |
| Vapour Pressure | 0.0152mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | WYJSXTRADJCQCC-UHFFFAOYSA-N |
| SMILES | COC1OC(OC)C2C3C=CC(C3)C12 |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-Methanoisobenzofuran,1,3,3a,4,7,7a-hexahydro-1,3-dimethoxy |
| 1,3-dimethoxy-1,3,3a,4,7,7a-hexahydro-4,7-methano-isobenzofuran |