Quinolinium,1-methyl-2-phenyl-, iodide (1:1) structure
|
Common Name | Quinolinium,1-methyl-2-phenyl-, iodide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 14886-84-1 | Molecular Weight | 347.19400 | |
| Density | 1.08g/cm3 | Boiling Point | 361.1ºC at 760 mmHg | |
| Molecular Formula | C16H14IN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.3ºC | |
| Name | 1-methyl-2-phenylquinolin-1-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 361.1ºC at 760 mmHg |
| Molecular Formula | C16H14IN |
| Molecular Weight | 347.19400 |
| Flash Point | 155.3ºC |
| Exact Mass | 347.01700 |
| PSA | 3.88000 |
| LogP | 0.33530 |
| Vapour Pressure | 2.12E-05mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | WOJQSFAGCWFYRF-UHFFFAOYSA-M |
| SMILES | C[n+]1c(-c2ccccc2)ccc2ccccc21.[I-] |
|
~3%
Quinolinium,1-m... CAS#:14886-84-1 |
| Literature: Mardenborough, Leroy G.; Zhu, Xue Y.; Fan, Pincheng; Jacob, Melissa R.; Khan, Shabana I.; Walker, Larry A.; Ablordeppey, Seth Y. Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 12 p. 3955 - 3963 |
|
~%
Quinolinium,1-m... CAS#:14886-84-1 |
| Literature: Kaufmann; Pla'y Janini Chemische Berichte, 1911 , vol. 44, p. 2674 |
| 1-Methyl-2-phenyl-chinolinium,Jodid |
| 1-methyl-2-phenyl-quinolinium,iodide |
| 1-Methyl-2-phenyl-chinolinium Iodid |
| N-methyl-2-phenylquinolium iodide |
| 2-Phenylquinoline methiodide |