7-N-Phenyl-mitomycin C
7-N-Phenyl-mitomycin C structure
|
Common Name | 7-N-Phenyl-mitomycin C | ||
|---|---|---|---|---|
| CAS Number | 14896-01-6 | Molecular Weight | 410.42300 | |
| Density | 1.48g/cm3 | Boiling Point | 642.9ºC at 760mmHg | |
| Molecular Formula | C21H22N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-N-Phenyl-mitomycin C |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 642.9ºC at 760mmHg |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.42300 |
| Flash Point | 342.6ºC |
| Exact Mass | 410.15900 |
| PSA | 133.89000 |
| LogP | 1.35570 |
| Vapour Pressure | 2.02E-16mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | DGUOEMCUTWLIGZ-YDBSYXHISA-N |
| SMILES | COC12C(COC(N)=O)C3=C(C(=O)C(C)=C(Nc4ccccc4)C3=O)N1CC1NC12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
CAS#:4055-39-4This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 7-N-Phenyl-mitomycin C? |
| A: Boiling point of 7-N-Phenyl-mitomycin C is 642.9ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of 7-N-Phenyl-mitomycin C? |
| A: Polar surface area (PSA) of 7-N-Phenyl-mitomycin C is 133.89000. |
| Q: What is the InChIKey of 7-N-Phenyl-mitomycin C? |
| A: InChIKey of 7-N-Phenyl-mitomycin C is DGUOEMCUTWLIGZ-YDBSYXHISA-N. |
| Q: What is the Chinese name of 14896-01-6? |
| A: Chinese name of 14896-01-6 is 14896-01-6. |
| Q: What is the SMILES notation of 7-N-Phenyl-mitomycin C? |
| A: SMILES notation of 7-N-Phenyl-mitomycin C is COC12C(COC(N)=O)C3=C(C(=O)C(C)=C(Nc4ccccc4)C3=O)N1CC1NC12. |
| Q: What is the molecular formula of 7-N-Phenyl-mitomycin C? |
| A: Molecular formula of 7-N-Phenyl-mitomycin C is C21H22N4O5. |
| Q: What is the LogP of 7-N-Phenyl-mitomycin C? |
| A: LogP of 7-N-Phenyl-mitomycin C is 1.35570. |
| Q: What is the CAS number of 7-N-Phenyl-mitomycin C? |
| A: CAS number of 7-N-Phenyl-mitomycin C is 14896-01-6. |
| Q: What are the upstream materials of 7-N-Phenyl-mitomycin C? |
| A: Related upstream materials(CAS) of 7-N-Phenyl-mitomycin C: 4055-39-4. |
| Q: What is the English name of 7-N-Phenyl-mitomycin C? |
| A: The English name of 7-N-Phenyl-mitomycin C is 7-N-Phenyl-mitomycin C. |