Benzamide,N-[[(4-methyl-2-thiazolyl)amino]thioxomethyl]- structure
|
Common Name | Benzamide,N-[[(4-methyl-2-thiazolyl)amino]thioxomethyl]- | ||
|---|---|---|---|---|
| CAS Number | 14901-11-2 | Molecular Weight | 277.36500 | |
| Density | 1.403g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H11N3OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-methyl-1,3-thiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.403g/cm3 |
|---|---|
| Molecular Formula | C12H11N3OS2 |
| Molecular Weight | 277.36500 |
| Exact Mass | 277.03400 |
| PSA | 114.35000 |
| LogP | 3.04220 |
| Index of Refraction | 1.715 |
| InChIKey | HBEPPLPZWCJWJH-UHFFFAOYSA-N |
| SMILES | Cc1csc(NC(=S)NC(=O)c2ccccc2)n1 |
|
~%
Benzamide,N-[[(... CAS#:14901-11-2 |
| Literature: Brands, Michael; Grande, Yolanda Cancho; Endermann, Rainer; Gahlmann, Reinhold; Krueger, Jochen; Raddatz, Siegfried Bioorganic and Medicinal Chemistry Letters, 2003 , vol. 13, # 16 p. 2641 - 2645 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| t0400-1499 |
| hms2890g18 |